C27H17F3N2O — CID 173110698
2,3-diphenyl-8-[3-(trifluoromethyl)phenyl]-6H-1,6-naphthyridin-5-one (PubChem CID 173110698) has the molecular formula C27H17F3N2O and a molecular weight of 442.44 g/mol. Its IUPAC name is 2,3-diphenyl-8-[3-(trifluoromethyl)phenyl]-6H-1,6-naphthyridin-5-one.
| Compound Name | 2,3-diphenyl-8-[3-(trifluoromethyl)phenyl]-6H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 173110698 |
| Molecular Formula | C27H17F3N2O |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 2,3-diphenyl-8-[3-(trifluoromethyl)phenyl]-6H-1,6-naphthyridin-5-one |
| SMILES | O=c1[nH]cc(-c2cccc(C(F)(F)F)c2)c2nc(-c3ccccc3)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C27H17F3N2O/c28-27(29,30)20-13-7-12-19(14-20)23-16-31-26(33)22-15-21(17-8-3-1-4-9-17)24(32-25(22)23)18-10-5-2-6-11-18/h1-16H,(H,31,33) |
| InChIKey | HETPIRKRIBZSCW-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |