C24H16N2OS — CID 173038182
2,3-diphenyl-8-thiophen-2-yl-6H-1,6-naphthyridin-5-one (PubChem CID 173038182) has the molecular formula C24H16N2OS and a molecular weight of 380.47 g/mol. Its IUPAC name is 2,3-diphenyl-8-thiophen-2-yl-6H-1,6-naphthyridin-5-one.
| Compound Name | 2,3-diphenyl-8-thiophen-2-yl-6H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 173038182 |
| Molecular Formula | C24H16N2OS |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 2,3-diphenyl-8-thiophen-2-yl-6H-1,6-naphthyridin-5-one |
| SMILES | O=c1[nH]cc(-c2cccs2)c2nc(-c3ccccc3)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C24H16N2OS/c27-24-19-14-18(16-8-3-1-4-9-16)22(17-10-5-2-6-11-17)26-23(19)20(15-25-24)21-12-7-13-28-21/h1-15H,(H,25,27) |
| InChIKey | UYTYPUIUTMNQAY-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |