C28H18N2OS — CID 173038202
8-(1-benzothiophen-7-yl)-2,3-diphenyl-6H-1,6-naphthyridin-5-one (PubChem CID 173038202) has the molecular formula C28H18N2OS and a molecular weight of 430.53 g/mol. Its IUPAC name is 8-(1-benzothiophen-7-yl)-2,3-diphenyl-6H-1,6-naphthyridin-5-one.
| Compound Name | 8-(1-benzothiophen-7-yl)-2,3-diphenyl-6H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 173038202 |
| Molecular Formula | C28H18N2OS |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 8-(1-benzothiophen-7-yl)-2,3-diphenyl-6H-1,6-naphthyridin-5-one |
| SMILES | O=c1[nH]cc(-c2cccc3ccsc23)c2nc(-c3ccccc3)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C28H18N2OS/c31-28-23-16-22(18-8-3-1-4-9-18)25(19-10-5-2-6-11-19)30-26(23)24(17-29-28)21-13-7-12-20-14-15-32-27(20)21/h1-17H,(H,29,31) |
| InChIKey | LRUQDBSPEADRSO-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |