C27H22N3OS+ — CID 58524555
[4-[5-oxo-3-phenyl-8-(3-sulfanylphenyl)-6H-1,6-naphthyridin-2-yl]phenyl]methylazanium (PubChem CID 58524555) has the molecular formula C27H22N3OS+ and a molecular weight of 436.56 g/mol. Its IUPAC name is [4-[5-oxo-3-phenyl-8-(3-sulfanylphenyl)-6H-1,6-naphthyridin-2-yl]phenyl]methylazanium.
| Compound Name | [4-[5-oxo-3-phenyl-8-(3-sulfanylphenyl)-6H-1,6-naphthyridin-2-yl]phenyl]methylazanium |
|---|---|
| PubChem CID | 58524555 |
| Molecular Formula | C27H22N3OS+ |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | [4-[5-oxo-3-phenyl-8-(3-sulfanylphenyl)-6H-1,6-naphthyridin-2-yl]phenyl]methylazanium |
| SMILES | [NH3+]Cc1ccc(-c2nc3c(-c4cccc(S)c4)c[nH]c(=O)c3cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H21N3OS/c28-15-17-9-11-19(12-10-17)25-22(18-5-2-1-3-6-18)14-23-26(30-25)24(16-29-27(23)31)20-7-4-8-21(32)13-20/h1-14,16,32H,15,28H2,(H,29,31)/p+1 |
| InChIKey | QFXIAWISODZJKR-UHFFFAOYSA-O |
| XLogP | 4.95 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|