C29H21F3N4O5 — CID 87232465
[4-[8-(4-nitrophenyl)-5-oxo-3-phenyl-6H-1,6-naphthyridin-2-yl]phenyl]methylazanium;2,2,2-trifluoroacetate (PubChem CID 87232465) has the molecular formula C29H21F3N4O5 and a molecular weight of 562.50 g/mol. Its IUPAC name is [4-[8-(4-nitrophenyl)-5-oxo-3-phenyl-6H-1,6-naphthyridin-2-yl]phenyl]methylazanium;2,2,2-trifluoroacetate.
| Compound Name | [4-[8-(4-nitrophenyl)-5-oxo-3-phenyl-6H-1,6-naphthyridin-2-yl]phenyl]methylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87232465 |
| Molecular Formula | C29H21F3N4O5 |
| Molecular Weight | 562.50 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | [4-[8-(4-nitrophenyl)-5-oxo-3-phenyl-6H-1,6-naphthyridin-2-yl]phenyl]methylazanium;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.[NH3+]Cc1ccc(-c2nc3c(-c4ccc([N+](=O)[O-])cc4)c[nH]c(=O)c3cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H20N4O3.C2HF3O2/c28-15-17-6-8-20(9-7-17)25-22(18-4-2-1-3-5-18)14-23-26(30-25)24(16-29-27(23)32)19-10-12-21(13-11-19)31(33)34;3-2(4,5)1(6)7/h1-14,16H,15,28H2,(H,29,32);(H,6,7) |
| InChIKey | NKFVFBGKPHAPJY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|