C30H19F3N4O3 — CID 67002194
[amino-[4-[8-(2-cyanophenyl)-5-oxo-3-phenyl-6H-1,6-naphthyridin-2-yl]phenyl]methyl] 2,2,2-trifluoroacetate (PubChem CID 67002194) has the molecular formula C30H19F3N4O3 and a molecular weight of 540.50 g/mol. Its IUPAC name is [amino-[4-[8-(2-cyanophenyl)-5-oxo-3-phenyl-6H-1,6-naphthyridin-2-yl]phenyl]methyl] 2,2,2-trifluoroacetate.
| Compound Name | [amino-[4-[8-(2-cyanophenyl)-5-oxo-3-phenyl-6H-1,6-naphthyridin-2-yl]phenyl]methyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67002194 |
| Molecular Formula | C30H19F3N4O3 |
| Molecular Weight | 540.50 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | [amino-[4-[8-(2-cyanophenyl)-5-oxo-3-phenyl-6H-1,6-naphthyridin-2-yl]phenyl]methyl] 2,2,2-trifluoroacetate |
| SMILES | N#Cc1ccccc1-c1c[nH]c(=O)c2cc(-c3ccccc3)c(-c3ccc(C(N)OC(=O)C(F)(F)F)cc3)nc12 |
| InChI | InChI=1S/C30H19F3N4O3/c31-30(32,33)29(39)40-27(35)19-12-10-18(11-13-19)25-22(17-6-2-1-3-7-17)14-23-26(37-25)24(16-36-28(23)38)21-9-5-4-8-20(21)15-34/h1-14,16,27H,35H2,(H,36,38) |
| InChIKey | JGWYIKNVTKIBBN-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.50 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|