C36H26F3N3O3 — CID 67001660
[amino-[4-[3-phenyl-5-(4-phenylmethoxyphenyl)-1,6-naphthyridin-2-yl]phenyl]methyl] 2,2,2-trifluoroacetate (PubChem CID 67001660) has the molecular formula C36H26F3N3O3 and a molecular weight of 605.62 g/mol. Its IUPAC name is [amino-[4-[3-phenyl-5-(4-phenylmethoxyphenyl)-1,6-naphthyridin-2-yl]phenyl]methyl] 2,2,2-trifluoroacetate.
| Compound Name | [amino-[4-[3-phenyl-5-(4-phenylmethoxyphenyl)-1,6-naphthyridin-2-yl]phenyl]methyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67001660 |
| Molecular Formula | C36H26F3N3O3 |
| Molecular Weight | 605.62 g/mol |
| Exact Mass | 605.19 |
| IUPAC Name | [amino-[4-[3-phenyl-5-(4-phenylmethoxyphenyl)-1,6-naphthyridin-2-yl]phenyl]methyl] 2,2,2-trifluoroacetate |
| SMILES | NC(OC(=O)C(F)(F)F)c1ccc(-c2nc3ccnc(-c4ccc(OCc5ccccc5)cc4)c3cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C36H26F3N3O3/c37-36(38,39)35(43)45-34(40)27-13-11-26(12-14-27)33-29(24-9-5-2-6-10-24)21-30-31(42-33)19-20-41-32(30)25-15-17-28(18-16-25)44-22-23-7-3-1-4-8-23/h1-21,34H,22,40H2 |
| InChIKey | HGDDVOQLBGHGNG-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.62 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|