C26H16Cl2N2O — CID 173038170
8-(3,5-dichlorophenyl)-2,3-diphenyl-6H-1,6-naphthyridin-5-one (PubChem CID 173038170) has the molecular formula C26H16Cl2N2O and a molecular weight of 443.33 g/mol. Its IUPAC name is 8-(3,5-dichlorophenyl)-2,3-diphenyl-6H-1,6-naphthyridin-5-one.
| Compound Name | 8-(3,5-dichlorophenyl)-2,3-diphenyl-6H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 173038170 |
| Molecular Formula | C26H16Cl2N2O |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 8-(3,5-dichlorophenyl)-2,3-diphenyl-6H-1,6-naphthyridin-5-one |
| SMILES | O=c1[nH]cc(-c2cc(Cl)cc(Cl)c2)c2nc(-c3ccccc3)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C26H16Cl2N2O/c27-19-11-18(12-20(28)13-19)23-15-29-26(31)22-14-21(16-7-3-1-4-8-16)24(30-25(22)23)17-9-5-2-6-10-17/h1-15H,(H,29,31) |
| InChIKey | UPTSJHAFMKOMOT-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |