C26H17N3O3 — CID 173038098
8-(4-nitrophenyl)-2,3-diphenyl-6H-1,6-naphthyridin-5-one (PubChem CID 173038098) has the molecular formula C26H17N3O3 and a molecular weight of 419.44 g/mol. Its IUPAC name is 8-(4-nitrophenyl)-2,3-diphenyl-6H-1,6-naphthyridin-5-one.
| Compound Name | 8-(4-nitrophenyl)-2,3-diphenyl-6H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 173038098 |
| Molecular Formula | C26H17N3O3 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 8-(4-nitrophenyl)-2,3-diphenyl-6H-1,6-naphthyridin-5-one |
| SMILES | O=c1[nH]cc(-c2ccc([N+](=O)[O-])cc2)c2nc(-c3ccccc3)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C26H17N3O3/c30-26-22-15-21(17-7-3-1-4-8-17)24(19-9-5-2-6-10-19)28-25(22)23(16-27-26)18-11-13-20(14-12-18)29(31)32/h1-16H,(H,27,30) |
| InChIKey | SHJJZNJCIKBLAY-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|