C28H24N6O3 — CID 11554977
2-[4-[[2-[(5-nitro-2-pyridinyl)amino]ethylamino]methyl]phenyl]-3-phenyl-6H-1,6-naphthyridin-5-one (PubChem CID 11554977) has the molecular formula C28H24N6O3 and a molecular weight of 492.54 g/mol. Its IUPAC name is 2-[4-[[2-[(5-nitro-2-pyridinyl)amino]ethylamino]methyl]phenyl]-3-phenyl-6H-1,6-naphthyridin-5-one.
| Compound Name | 2-[4-[[2-[(5-nitro-2-pyridinyl)amino]ethylamino]methyl]phenyl]-3-phenyl-6H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 11554977 |
| Molecular Formula | C28H24N6O3 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 2-[4-[[2-[(5-nitro-2-pyridinyl)amino]ethylamino]methyl]phenyl]-3-phenyl-6H-1,6-naphthyridin-5-one |
| SMILES | O=c1[nH]ccc2nc(-c3ccc(CNCCNc4ccc([N+](=O)[O-])cn4)cc3)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C28H24N6O3/c35-28-24-16-23(20-4-2-1-3-5-20)27(33-25(24)12-13-31-28)21-8-6-19(7-9-21)17-29-14-15-30-26-11-10-22(18-32-26)34(36)37/h1-13,16,18,29H,14-15,17H2,(H,30,32)(H,31,35) |
| InChIKey | YMKDWXDMZQTFOU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|