C34H33N5O — CID 11526572
3-phenyl-2-[4-[[2-(6-phenyl-3,6-diazabicyclo[3.2.0]heptan-3-yl)ethylamino]methyl]phenyl]-6H-1,6-naphthyridin-5-one (PubChem CID 11526572) has the molecular formula C34H33N5O and a molecular weight of 527.67 g/mol. Its IUPAC name is 3-phenyl-2-[4-[[2-(6-phenyl-3,6-diazabicyclo[3.2.0]heptan-3-yl)ethylamino]methyl]phenyl]-6H-1,6-naphthyridin-5-one.
| Compound Name | 3-phenyl-2-[4-[[2-(6-phenyl-3,6-diazabicyclo[3.2.0]heptan-3-yl)ethylamino]methyl]phenyl]-6H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 11526572 |
| Molecular Formula | C34H33N5O |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | 3-phenyl-2-[4-[[2-(6-phenyl-3,6-diazabicyclo[3.2.0]heptan-3-yl)ethylamino]methyl]phenyl]-6H-1,6-naphthyridin-5-one |
| SMILES | O=c1[nH]ccc2nc(-c3ccc(CNCCN4CC5CN(c6ccccc6)C5C4)cc3)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C34H33N5O/c40-34-30-19-29(25-7-3-1-4-8-25)33(37-31(30)15-16-36-34)26-13-11-24(12-14-26)20-35-17-18-38-21-27-22-39(32(27)23-38)28-9-5-2-6-10-28/h1-16,19,27,32,35H,17-18,20-23H2,(H,36,40) |
| InChIKey | JEIMNFKVUAPVIU-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|