C27H26N4OS — CID 177349423
2-[4-[(4-ethenylsulfanylpiperazin-1-yl)methyl]phenyl]-3-phenyl-6H-1,6-naphthyridin-5-one (PubChem CID 177349423) has the molecular formula C27H26N4OS and a molecular weight of 454.60 g/mol. Its IUPAC name is 2-[4-[(4-ethenylsulfanylpiperazin-1-yl)methyl]phenyl]-3-phenyl-6H-1,6-naphthyridin-5-one.
| Compound Name | 2-[4-[(4-ethenylsulfanylpiperazin-1-yl)methyl]phenyl]-3-phenyl-6H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 177349423 |
| Molecular Formula | C27H26N4OS |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 2-[4-[(4-ethenylsulfanylpiperazin-1-yl)methyl]phenyl]-3-phenyl-6H-1,6-naphthyridin-5-one |
| SMILES | C=CSN1CCN(Cc2ccc(-c3nc4cc[nH]c(=O)c4cc3-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C27H26N4OS/c1-2-33-31-16-14-30(15-17-31)19-20-8-10-22(11-9-20)26-23(21-6-4-3-5-7-21)18-24-25(29-26)12-13-28-27(24)32/h2-13,18H,1,14-17,19H2,(H,28,32) |
| InChIKey | JKTNNVAVGHHQSG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|