C31H33N3O — CID 143309013
2-[4-(1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridin-2-ylmethyl)phenyl]-3-phenyl-6H-1,6-naphthyridin-5-one (PubChem CID 143309013) has the molecular formula C31H33N3O and a molecular weight of 463.63 g/mol. Its IUPAC name is 2-[4-(1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridin-2-ylmethyl)phenyl]-3-phenyl-6H-1,6-naphthyridin-5-one.
| Compound Name | 2-[4-(1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridin-2-ylmethyl)phenyl]-3-phenyl-6H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 143309013 |
| Molecular Formula | C31H33N3O |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | 2-[4-(1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridin-2-ylmethyl)phenyl]-3-phenyl-6H-1,6-naphthyridin-5-one |
| SMILES | O=c1[nH]ccc2nc(-c3ccc(CN4CCC5CCCCCC5C4)cc3)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C31H33N3O/c35-31-28-19-27(24-8-4-2-5-9-24)30(33-29(28)15-17-32-31)25-13-11-22(12-14-25)20-34-18-16-23-7-3-1-6-10-26(23)21-34/h2,4-5,8-9,11-15,17,19,23,26H,1,3,6-7,10,16,18,20-21H2,(H,32,35) |
| InChIKey | ALEBLEBTIVNXTH-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |