C17H16F3N3O — CID 10914632
N-(2-methylanilino)-2-oxo-N'-[3-(trifluoromethyl)phenyl]propanimidamide (PubChem CID 10914632) has the molecular formula C17H16F3N3O and a molecular weight of 335.33 g/mol. Its IUPAC name is N-(2-methylanilino)-2-oxo-N'-[3-(trifluoromethyl)phenyl]propanimidamide.
| Compound Name | N-(2-methylanilino)-2-oxo-N'-[3-(trifluoromethyl)phenyl]propanimidamide |
|---|---|
| PubChem CID | 10914632 |
| Molecular Formula | C17H16F3N3O |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | N-(2-methylanilino)-2-oxo-N'-[3-(trifluoromethyl)phenyl]propanimidamide |
| SMILES | CC(=O)/C(=N\c1cccc(C(F)(F)F)c1)NNc1ccccc1C |
| InChI | InChI=1S/C17H16F3N3O/c1-11-6-3-4-9-15(11)22-23-16(12(2)24)21-14-8-5-7-13(10-14)17(18,19)20/h3-10,22H,1-2H3,(H,21,23) |
| InChIKey | YQJWFOGRWBSSFE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|