About 4-methylphenol;1-(2-methylphenyl)-1-[3-(trifluoromethyl)phenyl]iminopropan-2-one
4-methylphenol;1-(2-methylphenyl)-1-[3-(trifluoromethyl)phenyl]iminopropan-2-one (PubChem CID 143928953) has the molecular formula C24H22F3NO2
and a molecular weight of 413.44 g/mol. Its IUPAC name is 4-methylphenol;1-(2-methylphenyl)-1-[3-(trifluoromethyl)phenyl]iminopropan-2-one.
Molecular Properties
| Compound Name | 4-methylphenol;1-(2-methylphenyl)-1-[3-(trifluoromethyl)phenyl]iminopropan-2-one |
| PubChem CID | 143928953 |
| Molecular Formula | C24H22F3NO2 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 4-methylphenol;1-(2-methylphenyl)-1-[3-(trifluoromethyl)phenyl]iminopropan-2-one |
| SMILES | CC(=O)/C(=N\c1cccc(C(F)(F)F)c1)c1ccccc1C.Cc1ccc(O)cc1 |
| InChI | InChI=1S/C17H14F3NO.C7H8O/c1-11-6-3-4-9-15(11)16(12(2)22)21-14-8-5-7-13(10-14)17(18,19)20;1-6-2-4-7(8)5-3-6/h3-10H,1-2H3;2-5,8H,1H3/b21-16+; |
| InChIKey | UHAUBYWVUURDSS-JEBHESKQSA-N |
| XLogP | 6.42 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methylphenol;1-(2-methylphenyl)-1-[3-(trifluoromethyl)phenyl]iminopropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylphenol;1-(2-methylphenyl)-1-[3-(trifluoromethyl)phenyl]iminopropan-2-one?
The IUPAC name of 4-methylphenol;1-(2-methylphenyl)-1-[3-(trifluoromethyl)phenyl]iminopropan-2-one (CID 143928953) is 4-methylphenol;1-(2-methylphenyl)-1-[3-(trifluoromethyl)phenyl]iminopropan-2-one.
What is the SMILES notation for 4-methylphenol;1-(2-methylphenyl)-1-[3-(trifluoromethyl)phenyl]iminopropan-2-one?
The canonical SMILES for 4-methylphenol;1-(2-methylphenyl)-1-[3-(trifluoromethyl)phenyl]iminopropan-2-one is CC(=O)/C(=N\c1cccc(C(F)(F)F)c1)c1ccccc1C.Cc1ccc(O)cc1.
What is the InChIKey of 4-methylphenol;1-(2-methylphenyl)-1-[3-(trifluoromethyl)phenyl]iminopropan-2-one?
The InChIKey is UHAUBYWVUURDSS-JEBHESKQSA-N. The full InChI is InChI=1S/C17H14F3NO.C7H8O/c1-11-6-3-4-9-15(11)16(12(2)22)21-14-8-5-7-13(10-14)17(18,19)20;1-6-2-4-7(8)5-3-6/h3-10H,1-2H3;2-5,8H,1H3/b21-16+;.
What are the key properties of 4-methylphenol;1-(2-methylphenyl)-1-[3-(trifluoromethyl)phenyl]iminopropan-2-one?
4-methylphenol;1-(2-methylphenyl)-1-[3-(trifluoromethyl)phenyl]iminopropan-2-one has a molecular weight of 413.44 g/mol, XLogP of 6.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylphenol;1-(2-methylphenyl)-1-[3-(trifluoromethyl)phenyl]iminopropan-2-one is sourced from PubChem (CID 143928953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).