C12H10F6N2 — CID 143835208
4,4,4-trifluoro-N-methylidene-N'-[3-(trifluoromethyl)phenyl]butanimidamide (PubChem CID 143835208) has the molecular formula C12H10F6N2 and a molecular weight of 296.21 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-methylidene-N'-[3-(trifluoromethyl)phenyl]butanimidamide.
| Compound Name | 4,4,4-trifluoro-N-methylidene-N'-[3-(trifluoromethyl)phenyl]butanimidamide |
|---|---|
| PubChem CID | 143835208 |
| Molecular Formula | C12H10F6N2 |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 4,4,4-trifluoro-N-methylidene-N'-[3-(trifluoromethyl)phenyl]butanimidamide |
| SMILES | C=N/C(CCC(F)(F)F)=N\c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H10F6N2/c1-19-10(5-6-11(13,14)15)20-9-4-2-3-8(7-9)12(16,17)18/h2-4,7H,1,5-6H2/b20-10- |
| InChIKey | DXCVCXQSISAAOY-JMIUGGIZSA-N |
| XLogP | 4.78 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|