C10H4F9- — CID 139243033
1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(trifluoromethyl)benzene (PubChem CID 139243033) has the molecular formula C10H4F9- and a molecular weight of 295.12 g/mol. Its IUPAC name is 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(trifluoromethyl)benzene.
| Compound Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 139243033 |
| Molecular Formula | C10H4F9- |
| Molecular Weight | 295.12 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cccc([C-](C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H4F9/c11-8(12,13)6-3-1-2-5(4-6)7(9(14,15)16)10(17,18)19/h1-4H/q-1 |
| InChIKey | RFQPMKOOKFGAFY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.12 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|