C10H8Cl2N6O2 — CID 135688105
4-amino-N'-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 135688105) has the molecular formula C10H8Cl2N6O2 and a molecular weight of 315.12 g/mol. Its IUPAC name is 4-amino-N'-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-amino-N'-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 135688105 |
| Molecular Formula | C10H8Cl2N6O2 |
| Molecular Weight | 315.12 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 4-amino-N'-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | N/C(=N/N=C/c1cc(Cl)cc(Cl)c1O)c1nonc1N |
| InChI | InChI=1S/C10H8Cl2N6O2/c11-5-1-4(8(19)6(12)2-5)3-15-16-9(13)7-10(14)18-20-17-7/h1-3,19H,(H2,13,16)(H2,14,18)/b15-3+ |
| InChIKey | ZORRAEKZTSFBHB-CRKCGEKBSA-N |
| XLogP | 1.40 |
| TPSA | 135.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.12 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|