C11H13N3O3 — CID 157019147
N-(3,5-dimethoxyphenyl)-4-methyl-1,2,5-oxadiazol-3-amine (PubChem CID 157019147) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-4-methyl-1,2,5-oxadiazol-3-amine.
| Compound Name | N-(3,5-dimethoxyphenyl)-4-methyl-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 157019147 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-4-methyl-1,2,5-oxadiazol-3-amine |
| SMILES | COc1cc(Nc2nonc2C)cc(OC)c1 |
| InChI | InChI=1S/C11H13N3O3/c1-7-11(14-17-13-7)12-8-4-9(15-2)6-10(5-8)16-3/h4-6H,1-3H3,(H,12,14) |
| InChIKey | ALYNUKRCSYQUHG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |