C11H13N3O2S — CID 157013293
N-(3,5-dimethoxyphenyl)-3-methyl-1,2,4-thiadiazol-5-amine (PubChem CID 157013293) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-3-methyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(3,5-dimethoxyphenyl)-3-methyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 157013293 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-3-methyl-1,2,4-thiadiazol-5-amine |
| SMILES | COc1cc(Nc2nc(C)ns2)cc(OC)c1 |
| InChI | InChI=1S/C11H13N3O2S/c1-7-12-11(17-14-7)13-8-4-9(15-2)6-10(5-8)16-3/h4-6H,1-3H3,(H,12,13,14) |
| InChIKey | LSJWLFFDEZRISF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |