C12H12N2O3S — CID 130458792
2-(3,5-dimethoxyanilino)-1,3-thiazole-5-carbaldehyde (PubChem CID 130458792) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 2-(3,5-dimethoxyanilino)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-(3,5-dimethoxyanilino)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 130458792 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 2-(3,5-dimethoxyanilino)-1,3-thiazole-5-carbaldehyde |
| SMILES | COc1cc(Nc2ncc(C=O)s2)cc(OC)c1 |
| InChI | InChI=1S/C12H12N2O3S/c1-16-9-3-8(4-10(5-9)17-2)14-12-13-6-11(7-15)18-12/h3-7H,1-2H3,(H,13,14) |
| InChIKey | VSMWDGAOXLFJKS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|