C10H11N5O2S2 — CID 123581458
2-[2-[(5-formyl-1,3-thiazol-2-yl)amino]ethylamino]-1,3-thiazole-5-carboxamide (PubChem CID 123581458) has the molecular formula C10H11N5O2S2 and a molecular weight of 297.37 g/mol. Its IUPAC name is 2-[2-[(5-formyl-1,3-thiazol-2-yl)amino]ethylamino]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[2-[(5-formyl-1,3-thiazol-2-yl)amino]ethylamino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 123581458 |
| Molecular Formula | C10H11N5O2S2 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 2-[2-[(5-formyl-1,3-thiazol-2-yl)amino]ethylamino]-1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)c1cnc(NCCNc2ncc(C=O)s2)s1 |
| InChI | InChI=1S/C10H11N5O2S2/c11-8(17)7-4-15-10(19-7)13-2-1-12-9-14-3-6(5-16)18-9/h3-5H,1-2H2,(H2,11,17)(H,12,14)(H,13,15) |
| InChIKey | OCKPAOPVRWVSTI-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|