C7H9N3OS — CID 131041386
2-(prop-2-enylamino)-1,3-thiazole-5-carboxamide (PubChem CID 131041386) has the molecular formula C7H9N3OS and a molecular weight of 183.24 g/mol. Its IUPAC name is 2-(prop-2-enylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(prop-2-enylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 131041386 |
| Molecular Formula | C7H9N3OS |
| Molecular Weight | 183.24 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 2-(prop-2-enylamino)-1,3-thiazole-5-carboxamide |
| SMILES | C=CCNc1ncc(C(N)=O)s1 |
| InChI | InChI=1S/C7H9N3OS/c1-2-3-9-7-10-4-5(12-7)6(8)11/h2,4H,1,3H2,(H2,8,11)(H,9,10) |
| InChIKey | MYKCMQUUNIFYOH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|