C6H7N3O2S — CID 119098439
2-acetamido-1,3-thiazole-5-carboxamide (PubChem CID 119098439) has the molecular formula C6H7N3O2S and a molecular weight of 185.21 g/mol. Its IUPAC name is 2-acetamido-1,3-thiazole-5-carboxamide.
| Compound Name | 2-acetamido-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 119098439 |
| Molecular Formula | C6H7N3O2S |
| Molecular Weight | 185.21 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | 2-acetamido-1,3-thiazole-5-carboxamide |
| SMILES | CC(=O)Nc1ncc(C(N)=O)s1 |
| InChI | InChI=1S/C6H7N3O2S/c1-3(10)9-6-8-2-4(12-6)5(7)11/h2H,1H3,(H2,7,11)(H,8,9,10) |
| InChIKey | MRVKRNBDVORQFH-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.21 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |