C8H11N3OS — CID 174641583
2-(cyclopropylmethylamino)-1,3-thiazole-5-carboxamide (PubChem CID 174641583) has the molecular formula C8H11N3OS and a molecular weight of 197.26 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(cyclopropylmethylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 174641583 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 2-(cyclopropylmethylamino)-1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)c1cnc(NCC2CC2)s1 |
| InChI | InChI=1S/C8H11N3OS/c9-7(12)6-4-11-8(13-6)10-3-5-1-2-5/h4-5H,1-3H2,(H2,9,12)(H,10,11) |
| InChIKey | PHMVENWLEXJKCG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |