C12H26N2OS2 — CID 143328323
ethane;2-(2-sulfanylethylamino)-1,3-thiazole-5-carbaldehyde (PubChem CID 143328323) has the molecular formula C12H26N2OS2 and a molecular weight of 278.49 g/mol. Its IUPAC name is ethane;2-(2-sulfanylethylamino)-1,3-thiazole-5-carbaldehyde.
| Compound Name | ethane;2-(2-sulfanylethylamino)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 143328323 |
| Molecular Formula | C12H26N2OS2 |
| Molecular Weight | 278.49 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | ethane;2-(2-sulfanylethylamino)-1,3-thiazole-5-carbaldehyde |
| SMILES | CC.CC.CC.O=Cc1cnc(NCCS)s1 |
| InChI | InChI=1S/C6H8N2OS2.3C2H6/c9-4-5-3-8-6(11-5)7-1-2-10;3*1-2/h3-4,10H,1-2H2,(H,7,8);3*1-2H3 |
| InChIKey | DIMCGQDDMZTULD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|