C14H21ClN4O3S2 — CID 163681117
N-[5-[chloro(deuterio)methyl]-1,3-thiazol-2-yl]acetamide;N-(5-formyl-1,3-thiazol-2-yl)acetamide;methane (PubChem CID 163681117) has the molecular formula C14H21ClN4O3S2 and a molecular weight of 393.94 g/mol. Its IUPAC name is N-[5-[chloro(deuterio)methyl]-1,3-thiazol-2-yl]acetamide;N-(5-formyl-1,3-thiazol-2-yl)acetamide;methane.
| Compound Name | N-[5-[chloro(deuterio)methyl]-1,3-thiazol-2-yl]acetamide;N-(5-formyl-1,3-thiazol-2-yl)acetamide;methane |
|---|---|
| PubChem CID | 163681117 |
| Molecular Formula | C14H21ClN4O3S2 |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N-[5-[chloro(deuterio)methyl]-1,3-thiazol-2-yl]acetamide;N-(5-formyl-1,3-thiazol-2-yl)acetamide;methane |
| SMILES | C.C.CC(=O)Nc1ncc(C=O)s1.[2H]C(Cl)c1cnc(NC(C)=O)s1 |
| InChI | InChI=1S/C6H7ClN2OS.C6H6N2O2S.2CH4/c1-4(10)9-6-8-3-5(2-7)11-6;1-4(10)8-6-7-2-5(3-9)11-6;;/h3H,2H2,1H3,(H,8,9,10);2-3H,1H3,(H,7,8,10);2*1H4/i2D;;; |
| InChIKey | JKXNOOWKFKHNQB-OZPRGXNDSA-N |
| XLogP | 4.03 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|