C8H10ClN3OS — CID 174885566
acetonitrile;N-[5-(chloromethyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 174885566) has the molecular formula C8H10ClN3OS and a molecular weight of 231.71 g/mol. Its IUPAC name is acetonitrile;N-[5-(chloromethyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | acetonitrile;N-[5-(chloromethyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 174885566 |
| Molecular Formula | C8H10ClN3OS |
| Molecular Weight | 231.71 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | acetonitrile;N-[5-(chloromethyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC#N.CC(=O)Nc1ncc(CCl)s1 |
| InChI | InChI=1S/C6H7ClN2OS.C2H3N/c1-4(10)9-6-8-3-5(2-7)11-6;1-2-3/h3H,2H2,1H3,(H,8,9,10);1H3 |
| InChIKey | QRJFMSGCEWQTNM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.71 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|