C10H8ClN3OS — CID 88946989
2-[(6-chloro-3-pyridinyl)methylamino]-1,3-thiazole-5-carbaldehyde (PubChem CID 88946989) has the molecular formula C10H8ClN3OS and a molecular weight of 253.71 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methylamino]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methylamino]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 88946989 |
| Molecular Formula | C10H8ClN3OS |
| Molecular Weight | 253.71 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methylamino]-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(NCc2ccc(Cl)nc2)s1 |
| InChI | InChI=1S/C10H8ClN3OS/c11-9-2-1-7(3-12-9)4-13-10-14-5-8(6-15)16-10/h1-3,5-6H,4H2,(H,13,14) |
| InChIKey | YNAQGDIGWUZTLA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.71 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|