C10H8Cl3N3OS — CID 160877797
(6-chloro-3-pyridinyl)methanamine;2,4-dichloro-1,3-thiazole-5-carbaldehyde (PubChem CID 160877797) has the molecular formula C10H8Cl3N3OS and a molecular weight of 324.62 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)methanamine;2,4-dichloro-1,3-thiazole-5-carbaldehyde.
| Compound Name | (6-chloro-3-pyridinyl)methanamine;2,4-dichloro-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 160877797 |
| Molecular Formula | C10H8Cl3N3OS |
| Molecular Weight | 324.62 g/mol |
| Exact Mass | 322.95 |
| IUPAC Name | (6-chloro-3-pyridinyl)methanamine;2,4-dichloro-1,3-thiazole-5-carbaldehyde |
| SMILES | NCc1ccc(Cl)nc1.O=Cc1sc(Cl)nc1Cl |
| InChI | InChI=1S/C6H7ClN2.C4HCl2NOS/c7-6-2-1-5(3-8)4-9-6;5-3-2(1-8)9-4(6)7-3/h1-2,4H,3,8H2;1H |
| InChIKey | SMPZAFWANJKJLJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.62 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|