C8H7ClN4 — CID 178122205
2-chloro-5-(1,2,4-triazol-4-ylmethyl)pyridine (PubChem CID 178122205) has the molecular formula C8H7ClN4 and a molecular weight of 194.63 g/mol. Its IUPAC name is 2-chloro-5-(1,2,4-triazol-4-ylmethyl)pyridine.
| Compound Name | 2-chloro-5-(1,2,4-triazol-4-ylmethyl)pyridine |
|---|---|
| PubChem CID | 178122205 |
| Molecular Formula | C8H7ClN4 |
| Molecular Weight | 194.63 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 2-chloro-5-(1,2,4-triazol-4-ylmethyl)pyridine |
| SMILES | Clc1ccc(Cn2cnnc2)cn1 |
| InChI | InChI=1S/C8H7ClN4/c9-8-2-1-7(3-10-8)4-13-5-11-12-6-13/h1-3,5-6H,4H2 |
| InChIKey | IYZAJWKGSAFCLZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.63 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|