C9H11ClN2O2 — CID 130523883
(4R)-2-[(6-chloro-3-pyridinyl)methyl]-1,2-oxazolidin-4-ol (PubChem CID 130523883) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is (4R)-2-[(6-chloro-3-pyridinyl)methyl]-1,2-oxazolidin-4-ol.
| Compound Name | (4R)-2-[(6-chloro-3-pyridinyl)methyl]-1,2-oxazolidin-4-ol |
|---|---|
| PubChem CID | 130523883 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | (4R)-2-[(6-chloro-3-pyridinyl)methyl]-1,2-oxazolidin-4-ol |
| SMILES | O[C@H]1CON(Cc2ccc(Cl)nc2)C1 |
| InChI | InChI=1S/C9H11ClN2O2/c10-9-2-1-7(3-11-9)4-12-5-8(13)6-14-12/h1-3,8,13H,4-6H2/t8-/m1/s1 |
| InChIKey | FEXMRFNOSUAHJR-MRVPVSSYSA-N |
| XLogP | 0.84 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|