C13H19ClN4O2 — CID 132601711
8-amino-1-[(6-chloro-3-pyridinyl)methyl]-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridine-5,7-diol (PubChem CID 132601711) has the molecular formula C13H19ClN4O2 and a molecular weight of 298.77 g/mol. Its IUPAC name is 8-amino-1-[(6-chloro-3-pyridinyl)methyl]-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridine-5,7-diol.
| Compound Name | 8-amino-1-[(6-chloro-3-pyridinyl)methyl]-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridine-5,7-diol |
|---|---|
| PubChem CID | 132601711 |
| Molecular Formula | C13H19ClN4O2 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 8-amino-1-[(6-chloro-3-pyridinyl)methyl]-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridine-5,7-diol |
| SMILES | NC1C(O)CC(O)N2CCN(Cc3ccc(Cl)nc3)C12 |
| InChI | InChI=1S/C13H19ClN4O2/c14-10-2-1-8(6-16-10)7-17-3-4-18-11(20)5-9(19)12(15)13(17)18/h1-2,6,9,11-13,19-20H,3-5,7,15H2 |
| InChIKey | KUMDHRIUMXINFH-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|