C20H28Cl2N6 — CID 102314847
1,7-bis[(6-chloro-3-pyridinyl)methyl]-1,4,7,10-tetrazacyclododecane (PubChem CID 102314847) has the molecular formula C20H28Cl2N6 and a molecular weight of 423.39 g/mol. Its IUPAC name is 1,7-bis[(6-chloro-3-pyridinyl)methyl]-1,4,7,10-tetrazacyclododecane.
| Compound Name | 1,7-bis[(6-chloro-3-pyridinyl)methyl]-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 102314847 |
| Molecular Formula | C20H28Cl2N6 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 1,7-bis[(6-chloro-3-pyridinyl)methyl]-1,4,7,10-tetrazacyclododecane |
| SMILES | Clc1ccc(CN2CCNCCN(Cc3ccc(Cl)nc3)CCNCC2)cn1 |
| InChI | InChI=1S/C20H28Cl2N6/c21-19-3-1-17(13-25-19)15-27-9-5-23-7-11-28(12-8-24-6-10-27)16-18-2-4-20(22)26-14-18/h1-4,13-14,23-24H,5-12,15-16H2 |
| InChIKey | ZZUPTFYQDAQMOO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|