C9H14ClN3 — CID 18365460
4-(6-chloro-3-pyridinyl)butane-1,3-diamine (PubChem CID 18365460) has the molecular formula C9H14ClN3 and a molecular weight of 199.69 g/mol. Its IUPAC name is 4-(6-chloro-3-pyridinyl)butane-1,3-diamine.
| Compound Name | 4-(6-chloro-3-pyridinyl)butane-1,3-diamine |
|---|---|
| PubChem CID | 18365460 |
| Molecular Formula | C9H14ClN3 |
| Molecular Weight | 199.69 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 4-(6-chloro-3-pyridinyl)butane-1,3-diamine |
| SMILES | NCCC(N)Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C9H14ClN3/c10-9-2-1-7(6-13-9)5-8(12)3-4-11/h1-2,6,8H,3-5,11-12H2 |
| InChIKey | DPJNFBDJILCEQZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.69 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|