C16H20Cl2N4 — CID 18365459
1,6-bis(6-chloro-3-pyridinyl)hexane-2,5-diamine (PubChem CID 18365459) has the molecular formula C16H20Cl2N4 and a molecular weight of 339.27 g/mol. Its IUPAC name is 1,6-bis(6-chloro-3-pyridinyl)hexane-2,5-diamine.
| Compound Name | 1,6-bis(6-chloro-3-pyridinyl)hexane-2,5-diamine |
|---|---|
| PubChem CID | 18365459 |
| Molecular Formula | C16H20Cl2N4 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 1,6-bis(6-chloro-3-pyridinyl)hexane-2,5-diamine |
| SMILES | NC(CCC(N)Cc1ccc(Cl)nc1)Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C16H20Cl2N4/c17-15-5-1-11(9-21-15)7-13(19)3-4-14(20)8-12-2-6-16(18)22-10-12/h1-2,5-6,9-10,13-14H,3-4,7-8,19-20H2 |
| InChIKey | RHZLHIOTVRPMOG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|