C9H9ClN4S — CID 133319260
N-[(6-chloro-3-pyridinyl)methyl]-3-methyl-1,2,4-thiadiazol-5-amine (PubChem CID 133319260) has the molecular formula C9H9ClN4S and a molecular weight of 240.72 g/mol. Its IUPAC name is N-[(6-chloro-3-pyridinyl)methyl]-3-methyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-[(6-chloro-3-pyridinyl)methyl]-3-methyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 133319260 |
| Molecular Formula | C9H9ClN4S |
| Molecular Weight | 240.72 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | N-[(6-chloro-3-pyridinyl)methyl]-3-methyl-1,2,4-thiadiazol-5-amine |
| SMILES | Cc1nsc(NCc2ccc(Cl)nc2)n1 |
| InChI | InChI=1S/C9H9ClN4S/c1-6-13-9(15-14-6)12-5-7-2-3-8(10)11-4-7/h2-4H,5H2,1H3,(H,12,13,14) |
| InChIKey | OJFZVFIRPSLTQA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.72 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|