C6H10ClN3S — CID 65273352
N-(3-chloropropyl)-3-methyl-1,2,4-thiadiazol-5-amine (PubChem CID 65273352) has the molecular formula C6H10ClN3S and a molecular weight of 191.69 g/mol. Its IUPAC name is N-(3-chloropropyl)-3-methyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(3-chloropropyl)-3-methyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65273352 |
| Molecular Formula | C6H10ClN3S |
| Molecular Weight | 191.69 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | N-(3-chloropropyl)-3-methyl-1,2,4-thiadiazol-5-amine |
| SMILES | Cc1nsc(NCCCCl)n1 |
| InChI | InChI=1S/C6H10ClN3S/c1-5-9-6(11-10-5)8-4-2-3-7/h2-4H2,1H3,(H,8,9,10) |
| InChIKey | JVSFQRFWTMXGFJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.69 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|