C12H23N3S — CID 107816082
3-methyl-N-(7-methyloctyl)-1,2,4-thiadiazol-5-amine (PubChem CID 107816082) has the molecular formula C12H23N3S and a molecular weight of 241.40 g/mol. Its IUPAC name is 3-methyl-N-(7-methyloctyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-methyl-N-(7-methyloctyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 107816082 |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 3-methyl-N-(7-methyloctyl)-1,2,4-thiadiazol-5-amine |
| SMILES | Cc1nsc(NCCCCCCC(C)C)n1 |
| InChI | InChI=1S/C12H23N3S/c1-10(2)8-6-4-5-7-9-13-12-14-11(3)15-16-12/h10H,4-9H2,1-3H3,(H,13,14,15) |
| InChIKey | VNBWHJSSJOZHGP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|