C10H19N3S — CID 65271707
3-ethyl-N-(4-methylpentyl)-1,2,4-thiadiazol-5-amine (PubChem CID 65271707) has the molecular formula C10H19N3S and a molecular weight of 213.35 g/mol. Its IUPAC name is 3-ethyl-N-(4-methylpentyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-ethyl-N-(4-methylpentyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65271707 |
| Molecular Formula | C10H19N3S |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 3-ethyl-N-(4-methylpentyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CCc1nsc(NCCCC(C)C)n1 |
| InChI | InChI=1S/C10H19N3S/c1-4-9-12-10(14-13-9)11-7-5-6-8(2)3/h8H,4-7H2,1-3H3,(H,11,12,13) |
| InChIKey | LLVASDZMONVQSF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|