C6H10FN3S — CID 130478087
3-ethyl-N-(2-fluoroethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 130478087) has the molecular formula C6H10FN3S and a molecular weight of 175.23 g/mol. Its IUPAC name is 3-ethyl-N-(2-fluoroethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-ethyl-N-(2-fluoroethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 130478087 |
| Molecular Formula | C6H10FN3S |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 3-ethyl-N-(2-fluoroethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CCc1nsc(NCCF)n1 |
| InChI | InChI=1S/C6H10FN3S/c1-2-5-9-6(11-10-5)8-4-3-7/h2-4H2,1H3,(H,8,9,10) |
| InChIKey | WNTJPHNRBZUZMC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |