C8H15N3OS — CID 107269261
5-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]pentan-2-ol (PubChem CID 107269261) has the molecular formula C8H15N3OS and a molecular weight of 201.29 g/mol. Its IUPAC name is 5-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]pentan-2-ol.
| Compound Name | 5-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 107269261 |
| Molecular Formula | C8H15N3OS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 5-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]pentan-2-ol |
| SMILES | Cc1nsc(NCCCC(C)O)n1 |
| InChI | InChI=1S/C8H15N3OS/c1-6(12)4-3-5-9-8-10-7(2)11-13-8/h6,12H,3-5H2,1-2H3,(H,9,10,11) |
| InChIKey | FFNYSIKAJMREKL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|