C7H13N3OS — CID 106128419
5-(1,3,4-thiadiazol-2-ylamino)pentan-2-ol (PubChem CID 106128419) has the molecular formula C7H13N3OS and a molecular weight of 187.27 g/mol. Its IUPAC name is 5-(1,3,4-thiadiazol-2-ylamino)pentan-2-ol.
| Compound Name | 5-(1,3,4-thiadiazol-2-ylamino)pentan-2-ol |
|---|---|
| PubChem CID | 106128419 |
| Molecular Formula | C7H13N3OS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 5-(1,3,4-thiadiazol-2-ylamino)pentan-2-ol |
| SMILES | CC(O)CCCNc1nncs1 |
| InChI | InChI=1S/C7H13N3OS/c1-6(11)3-2-4-8-7-10-9-5-12-7/h5-6,11H,2-4H2,1H3,(H,8,10) |
| InChIKey | GYYCIWHIOXJVRM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|