C10H17N3O — CID 106128597
5-[(5-methylpyridazin-3-yl)amino]pentan-2-ol (PubChem CID 106128597) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 5-[(5-methylpyridazin-3-yl)amino]pentan-2-ol.
| Compound Name | 5-[(5-methylpyridazin-3-yl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 106128597 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 5-[(5-methylpyridazin-3-yl)amino]pentan-2-ol |
| SMILES | Cc1cnnc(NCCCC(C)O)c1 |
| InChI | InChI=1S/C10H17N3O/c1-8-6-10(13-12-7-8)11-5-3-4-9(2)14/h6-7,9,14H,3-5H2,1-2H3,(H,11,13) |
| InChIKey | PFGMODNEFYXQGC-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|