C8H14N4 — CID 106549356
N'-(5-methylpyridazin-3-yl)propane-1,3-diamine (PubChem CID 106549356) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is N'-(5-methylpyridazin-3-yl)propane-1,3-diamine.
| Compound Name | N'-(5-methylpyridazin-3-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 106549356 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | N'-(5-methylpyridazin-3-yl)propane-1,3-diamine |
| SMILES | Cc1cnnc(NCCCN)c1 |
| InChI | InChI=1S/C8H14N4/c1-7-5-8(12-11-6-7)10-4-2-3-9/h5-6H,2-4,9H2,1H3,(H,10,12) |
| InChIKey | NDGOKXVCADITOQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|