C11H20BrN3S — CID 107817577
5-bromo-N-(7-methyloctyl)-1,3,4-thiadiazol-2-amine (PubChem CID 107817577) has the molecular formula C11H20BrN3S and a molecular weight of 306.27 g/mol. Its IUPAC name is 5-bromo-N-(7-methyloctyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-bromo-N-(7-methyloctyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 107817577 |
| Molecular Formula | C11H20BrN3S |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 5-bromo-N-(7-methyloctyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CC(C)CCCCCCNc1nnc(Br)s1 |
| InChI | InChI=1S/C11H20BrN3S/c1-9(2)7-5-3-4-6-8-13-11-15-14-10(12)16-11/h9H,3-8H2,1-2H3,(H,13,15) |
| InChIKey | PYYIAPFHBJJAHL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|