C14H23ClN2O2S — CID 107817531
methyl 4-chloro-2-(7-methyloctylamino)-1,3-thiazole-5-carboxylate (PubChem CID 107817531) has the molecular formula C14H23ClN2O2S and a molecular weight of 318.87 g/mol. Its IUPAC name is methyl 4-chloro-2-(7-methyloctylamino)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 4-chloro-2-(7-methyloctylamino)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 107817531 |
| Molecular Formula | C14H23ClN2O2S |
| Molecular Weight | 318.87 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | methyl 4-chloro-2-(7-methyloctylamino)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(NCCCCCCC(C)C)nc1Cl |
| InChI | InChI=1S/C14H23ClN2O2S/c1-10(2)8-6-4-5-7-9-16-14-17-12(15)11(20-14)13(18)19-3/h10H,4-9H2,1-3H3,(H,16,17) |
| InChIKey | IMUNAUCMSRPEEO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.87 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|