C9H11ClN2O2S — CID 104952855
methyl 4-chloro-2-(2-methylprop-2-enylamino)-1,3-thiazole-5-carboxylate (PubChem CID 104952855) has the molecular formula C9H11ClN2O2S and a molecular weight of 246.72 g/mol. Its IUPAC name is methyl 4-chloro-2-(2-methylprop-2-enylamino)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 4-chloro-2-(2-methylprop-2-enylamino)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 104952855 |
| Molecular Formula | C9H11ClN2O2S |
| Molecular Weight | 246.72 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | methyl 4-chloro-2-(2-methylprop-2-enylamino)-1,3-thiazole-5-carboxylate |
| SMILES | C=C(C)CNc1nc(Cl)c(C(=O)OC)s1 |
| InChI | InChI=1S/C9H11ClN2O2S/c1-5(2)4-11-9-12-7(10)6(15-9)8(13)14-3/h1,4H2,2-3H3,(H,11,12) |
| InChIKey | AYYGKYXMTSWDHR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.72 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|