C18H17N3O3S — CID 87521287
4-methoxy-N-[2-(4-methoxyanilino)-1,3-thiazol-5-yl]benzamide (PubChem CID 87521287) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is 4-methoxy-N-[2-(4-methoxyanilino)-1,3-thiazol-5-yl]benzamide.
| Compound Name | 4-methoxy-N-[2-(4-methoxyanilino)-1,3-thiazol-5-yl]benzamide |
|---|---|
| PubChem CID | 87521287 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 4-methoxy-N-[2-(4-methoxyanilino)-1,3-thiazol-5-yl]benzamide |
| SMILES | COc1ccc(Nc2ncc(NC(=O)c3ccc(OC)cc3)s2)cc1 |
| InChI | InChI=1S/C18H17N3O3S/c1-23-14-7-3-12(4-8-14)17(22)21-16-11-19-18(25-16)20-13-5-9-15(24-2)10-6-13/h3-11H,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | QMPUSGVPOGCEIP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |