C20H18N4O3S — CID 59453545
2-(4-ethenylanilino)-5-[(4-methoxybenzoyl)amino]-1,3-thiazole-4-carboxamide (PubChem CID 59453545) has the molecular formula C20H18N4O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is 2-(4-ethenylanilino)-5-[(4-methoxybenzoyl)amino]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(4-ethenylanilino)-5-[(4-methoxybenzoyl)amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59453545 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 2-(4-ethenylanilino)-5-[(4-methoxybenzoyl)amino]-1,3-thiazole-4-carboxamide |
| SMILES | C=Cc1ccc(Nc2nc(C(N)=O)c(NC(=O)c3ccc(OC)cc3)s2)cc1 |
| InChI | InChI=1S/C20H18N4O3S/c1-3-12-4-8-14(9-5-12)22-20-23-16(17(21)25)19(28-20)24-18(26)13-6-10-15(27-2)11-7-13/h3-11H,1H2,2H3,(H2,21,25)(H,22,23)(H,24,26) |
| InChIKey | KIXOLTOILAVHRJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |